chematic cookbook — 20 common tasks
Each task is copy-paste-ready. Examples use aspirin (CC(=O)Oc1ccccc1C(=O)O) as the reference molecule.
1. Get basic properties from a SMILES string
mol = chematic.from_smiles("CC(=O)Oc1ccccc1C(=O)O") # aspirin
print(mol.mw) # 180.16
print(mol.logp) # 1.31
print(mol.tpsa) # 63.6
print(mol.hbd, mol.hba) # 1 4
print(mol.qed) # 0.55
print(mol.formula) # C9H8O4
2. Check drug-likeness filters
mol = chematic.from_smiles("CC(=O)Oc1ccccc1C(=O)O")
print(mol.lipinski_passes) # True
print(mol.veber_passes) # True
print(mol.ghose_passes) # True
print(mol.pains_passes) # True
print(mol.brenk_passes) # True
3. Predict pKa
mol = chematic.from_smiles("CC(=O)Oc1ccccc1C(=O)O")
pka = mol.pka()
print(pka["most_acidic"]) # 3.49 (carboxylic acid)
print(pka["most_basic"]) # None (no basic site)
4. Get an ADMET profile
mol = chematic.from_smiles("CC(=O)Oc1ccccc1C(=O)O")
profile = mol.admet()
# {
# "bbb": False,
# "bbb_score": -1.3,
# "caco2": -4.9, # log Papp (Caco-2)
# "herg_risk": 0.12, # 0–1 risk score
# "cyp3a4_risk": 0.21,
# }
5. Compute fingerprint similarity
aspirin = chematic.from_smiles("CC(=O)Oc1ccccc1C(=O)O")
ibuprofen = chematic.from_smiles("CC(C)Cc1ccc(CC(C)C(=O)O)cc1")
sim = chematic.tanimoto(aspirin.ecfp4(), ibuprofen.ecfp4())
print(f"Tanimoto (ECFP4): {sim:.3f}") # 0.148
6. Read an SDF file into a DataFrame
import pandas as pd
records = list(chematic.iter_sdf("library.sdf"))
df = pd.DataFrame({
"name": [r.name for r in records],
"smiles": [r.mol.smiles for r in records],
"mw": [r.mol.mw for r in records],
"logp": [r.mol.logp for r in records],
"qed": [r.mol.qed for r in records],
})
print(df.head())
7. Compute descriptors for many SMILES in parallel
import pandas as pd
smiles_list = ["CCO", "c1ccccc1", "CC(=O)O", "c1cccnc1", "CCCCCCCC"]
# Automatically parallelized across CPU cores
df = pd.DataFrame(chematic.bulk.descriptors(smiles_list))
print(df[["mw", "logp", "tpsa", "qed"]].round(2))
8. Get an ECFP4 matrix as numpy (for ML)
import numpy as np
smiles_list = ["CCO", "c1ccccc1", "CC(=O)O"]
# shape: (N, 2048), dtype: uint8
X = chematic.bulk.ecfp4(smiles_list)
# Drop directly into scikit-learn
from sklearn.ensemble import RandomForestClassifier
# clf.fit(X, y)
9. Compute a Tanimoto similarity matrix
smiles_list = ["CCO", "c1ccccc1", "CC(=O)O", "c1cccnc1"]
# shape: (N, N), dtype: float32
matrix = chematic.bulk.tanimoto(smiles_list, smiles_list)
print(matrix.round(2))
10. Virtual screening (similarity search)
library_smiles = [...] # tens of thousands of molecules is fine
query = "CC(=O)Oc1ccccc1C(=O)O"
scores = chematic.bulk.tanimoto_search(query, library_smiles) # (N,) float32
# Top 10 hits
top_indices = scores.argsort()[::-1][:10]
for i in top_indices:
print(f"{library_smiles[i]}: {scores[i]:.3f}")
11. Fast nearest-neighbour search with LSH
# Designed for large libraries (hundreds of thousands of molecules)
idx = chematic.SimilarityIndex.from_smiles(library_smiles)
hits = idx.search("CC(=O)Oc1ccccc1C(=O)O", threshold=0.5, k=20)
for mol_idx, score in hits:
print(f"{library_smiles[mol_idx]}: {score:.3f}")
12. Substructure search with SMARTS
mol = chematic.from_smiles("CC(=O)Oc1ccccc1C(=O)O")
# Boolean match
if chematic.smarts_match("[CX3](=O)[OX2H1]", mol):
print("carboxylic acid found")
# Get matched atom indices
matches = chematic.smarts_find("[CX3](=O)[OX2H1]", mol)
print(matches) # [[7, 8, 9], ...]
13. Standardise a molecule
# Remove salts/solvents, neutralise charges, canonicalise tautomers
mol = chematic.from_smiles("[Na+].[O-]c1ccccc1")
clean = mol.standardize()
print(clean.smiles) # Oc1ccccc1 (phenol)
# Individual operations
mol.largest_fragment() # keep the largest connected fragment
mol.neutralize() # neutralise formal charges
mol.remove_isotopes() # strip isotope labels
mol.remove_stereo() # remove stereochemistry
14. Extract the Murcko scaffold
mol = chematic.from_smiles("CC(=O)Oc1ccccc1C(=O)O")
scaffold = mol.scaffold()
print(scaffold.smiles) # c1ccc(CC(=O)O)cc1 (Murcko)
generic = mol.generic_scaffold()
print(generic.smiles) # generic form (all atoms → C, all bonds → single)
15. BRICS fragmentation
mol = chematic.from_smiles("CC(=O)Nc1ccc(O)cc1") # paracetamol
frags = mol.brics_fragments()
for f in frags:
print(f.smiles)
16. Enumerate and canonicalise tautomers
mol = chematic.from_smiles("OC1=CC=CC=N1") # 2-pyridinol
canonical = mol.canonical_tautomer()
print(canonical.smiles) # O=C1CC=CC=N1
all_tautomers = mol.enumerate_tautomers()
print(len(all_tautomers)) # typically 2–5
17. Find the Maximum Common Substructure (MCS)
mol1 = chematic.from_smiles("CC(=O)Oc1ccccc1C(=O)O") # aspirin
mol2 = chematic.from_smiles("CC(=O)Nc1ccc(O)cc1") # paracetamol
mcs = chematic.find_mcs([mol1, mol2])
if mcs:
print(mcs.smiles) # common substructure
18. Apply a reaction with SMIRKS
# Deprotonate a phenol
phenol = chematic.from_smiles("c1ccccc1O")
products = chematic.run_smirks("[OH:1]>>[O-:1]", [phenol])
for product_set in products:
for p in product_set:
print(p.smiles) # [O-]c1ccccc1
19. Render SVG in Jupyter
from IPython.display import SVG, display
mol = chematic.from_smiles("CC(=O)Oc1ccccc1C(=O)O")
# Single molecule
display(SVG(mol.svg()))
# Highlight atoms matched by a SMARTS query
matches = chematic.smarts_find("[CX3](=O)[OX2H1]", mol)
atoms = [i for match in matches for i in match]
display(SVG(mol.svg_highlighted(atoms, color="#FF6B6B")))
# Grid view
mols = [chematic.from_smiles(s) for s in ["CCO", "c1ccccc1", "CC(=O)O", "CCCC"]]
display(SVG(chematic.depict_grid(mols, cols=2)))
20. Export all descriptors + filter results to a DataFrame
import pandas as pd
smiles_list = [
"CC(=O)Oc1ccccc1C(=O)O", # aspirin
"CC(C)Cc1ccc(CC(C)C(=O)O)cc1", # ibuprofen
"c1ccc2ccccc2c1", # naphthalene
"CCCCCCCCCCCCCCCCCC(=O)O", # stearic acid
]
df = pd.DataFrame(chematic.bulk.descriptors(smiles_list))
# includes lipinski_passes, pains_passes, brenk_passes, etc.
print(df[["mw", "logp", "tpsa", "qed", "lipinski_passes", "pains_passes"]].round(2))
Bonus: HTML grid report
import chematic
smiles_list = [
"CC(=O)Oc1ccccc1C(=O)O", # aspirin
"CC(C)Cc1ccc(CC(C)C(=O)O)cc1", # ibuprofen
"Cn1cnc2c1c(=O)n(C)c(=O)n2C", # caffeine
]
mols = [chematic.from_smiles(s) for s in smiles_list]
names = ["aspirin", "ibuprofen", "caffeine"]
# Returns self-contained HTML string; also writes to file if output= given
report = chematic.report(mols, names=names, title="My compounds")
report.save("report.html") # write to disk
# display(report) # Jupyter: renders inline automatically
Each molecule card shows: 2D structure · MW / LogP / TPSA · HBD / HBA / QED · Lipinski / PAINS / Brenk badges. Cards are sorted by QED descending. No external CSS or JavaScript — the file opens standalone in any browser.
Full example: examples/html_report.py
# Side-by-side comparison of two molecules
aspirin = chematic.from_smiles("CC(=O)Oc1ccccc1C(=O)O")
ibuprofen = chematic.from_smiles("CC(C)Cc1ccc(CC(C)C(=O)O)cc1")
report = chematic.compare(aspirin, ibuprofen, names=("Aspirin", "Ibuprofen"))
report.save("compare.html")
Bonus: Natural-language summary and structural diff
mol = chematic.from_smiles("CC(=O)Oc1ccccc1C(=O)O") # aspirin
# Human-readable summary — suitable for LLM prompts or MCP responses
print(mol.describe())
# Molecular weight 180.2 Da, formula C9H8O4.
# LogP 1.31 (mildly lipophilic), TPSA 63.6 Ų.
# HBD 1, HBA 3, 2 rotatable bond(s), 1 aromatic ring(s).
# Drug-likeness: no Lipinski rule-of-5 violations. Likely orally bioavailable (passes Veber criteria).
# QED 0.55 (0 = non-drug-like, 1 = ideal).
# No structural alerts (PAINS / Brenk clean).
# Directional structural diff (aspirin → ibuprofen)
ibuprofen = chematic.from_smiles("CC(C)Cc1ccc(CC(C)C(=O)O)cc1")
d = mol.diff(ibuprofen)
print(d["summary"]) # "+C7, -O2. ΔLogP +2.75, ΔTPSA -26.3 Ų, ΔMW +66.1 Da."
print(d["common_atoms"]) # MCS size
print(d["delta_logp"]) # 2.75
print(d["delta_elements"]) # {"C": 7, "O": -2}